C23H27F2O10S- — CID 58264832
(2,2-difluoro-2-oxidoperoxysulfanylethyl) 3-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]adamantane-1-carboxylate (PubChem CID 58264832) has the molecular formula C23H27F2O10S- and a molecular weight of 533.52 g/mol. Its IUPAC name is (2,2-difluoro-2-oxidoperoxysulfanylethyl) 3-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]adamantane-1-carboxylate.
| Compound Name | (2,2-difluoro-2-oxidoperoxysulfanylethyl) 3-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 58264832 |
| Molecular Formula | C23H27F2O10S- |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | (2,2-difluoro-2-oxidoperoxysulfanylethyl) 3-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]adamantane-1-carboxylate |
| SMILES | O=C(COC12CC3CC(C1)CC(C(=O)OCC(F)(F)SOO[O-])(C3)C2)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C23H28F2O10S/c24-23(25,36-35-34-29)10-30-20(28)21-4-11-1-12(5-21)7-22(6-11,9-21)31-8-16(26)32-17-13-2-14-15(3-13)19(27)33-18(14)17/h11-15,17-18,29H,1-10H2/p-1 |
| InChIKey | CLGBTXMSUFCVLP-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|