C19H22F2O11S — CID 88942468
1,1-difluoro-2-oxo-2-[[5-[2-oxo-2-(2-oxooxolan-3-yl)oxyethoxy]carbonyl-2-adamantyl]oxy]ethanesulfonic acid (PubChem CID 88942468) has the molecular formula C19H22F2O11S and a molecular weight of 496.44 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[5-[2-oxo-2-(2-oxooxolan-3-yl)oxyethoxy]carbonyl-2-adamantyl]oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[[5-[2-oxo-2-(2-oxooxolan-3-yl)oxyethoxy]carbonyl-2-adamantyl]oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 88942468 |
| Molecular Formula | C19H22F2O11S |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[5-[2-oxo-2-(2-oxooxolan-3-yl)oxyethoxy]carbonyl-2-adamantyl]oxy]ethanesulfonic acid |
| SMILES | O=C(COC(=O)C12CC3CC(C1)C(OC(=O)C(F)(F)S(=O)(=O)O)C(C3)C2)OC1CCOC1=O |
| InChI | InChI=1S/C19H22F2O11S/c20-19(21,33(26,27)28)17(25)32-14-10-3-9-4-11(14)7-18(5-9,6-10)16(24)30-8-13(22)31-12-1-2-29-15(12)23/h9-12,14H,1-8H2,(H,26,27,28) |
| InChIKey | MOGHCNWDATTYMD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|