C27H36F2O10S — CID 89408594
2-[[5-[3-(adamantane-1-carbonyloxy)-2-hydroxypropoxy]carbonyl-2-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 89408594) has the molecular formula C27H36F2O10S and a molecular weight of 590.64 g/mol. Its IUPAC name is 2-[[5-[3-(adamantane-1-carbonyloxy)-2-hydroxypropoxy]carbonyl-2-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[5-[3-(adamantane-1-carbonyloxy)-2-hydroxypropoxy]carbonyl-2-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89408594 |
| Molecular Formula | C27H36F2O10S |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 2-[[5-[3-(adamantane-1-carbonyloxy)-2-hydroxypropoxy]carbonyl-2-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OCC(O)COC(=O)C12CC3CC(C1)C(OC(=O)C(F)(F)S(=O)(=O)O)C(C3)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H36F2O10S/c28-27(29,40(34,35)36)24(33)39-21-18-4-17-5-19(21)11-26(9-17,10-18)23(32)38-13-20(30)12-37-22(31)25-6-14-1-15(7-25)3-16(2-14)8-25/h14-21,30H,1-13H2,(H,34,35,36) |
| InChIKey | AEHOZQONRPNZGR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|