C15H18F6O6S — CID 118651847
1,1,1,3,3,3-hexafluoro-2-[(4-hydroxyadamantane-1-carbonyl)oxymethyl]propane-2-sulfonic acid (PubChem CID 118651847) has the molecular formula C15H18F6O6S and a molecular weight of 440.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[(4-hydroxyadamantane-1-carbonyl)oxymethyl]propane-2-sulfonic acid.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[(4-hydroxyadamantane-1-carbonyl)oxymethyl]propane-2-sulfonic acid |
|---|---|
| PubChem CID | 118651847 |
| Molecular Formula | C15H18F6O6S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[(4-hydroxyadamantane-1-carbonyl)oxymethyl]propane-2-sulfonic acid |
| SMILES | O=C(OCC(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O)C12CC3CC(C1)C(O)C(C3)C2 |
| InChI | InChI=1S/C15H18F6O6S/c16-14(17,18)13(15(19,20)21,28(24,25)26)6-27-11(23)12-3-7-1-8(4-12)10(22)9(2-7)5-12/h7-10,22H,1-6H2,(H,24,25,26) |
| InChIKey | ANVFJLVFSNJBKO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|