C28H38F4O7 — CID 89280250
[2-(4-hydroxyadamantane-1-carbonyl)oxy-3-(1,1,2,2-tetrafluoropropoxy)propyl] 4-hydroxyadamantane-1-carboxylate (PubChem CID 89280250) has the molecular formula C28H38F4O7 and a molecular weight of 562.60 g/mol. Its IUPAC name is [2-(4-hydroxyadamantane-1-carbonyl)oxy-3-(1,1,2,2-tetrafluoropropoxy)propyl] 4-hydroxyadamantane-1-carboxylate.
| Compound Name | [2-(4-hydroxyadamantane-1-carbonyl)oxy-3-(1,1,2,2-tetrafluoropropoxy)propyl] 4-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 89280250 |
| Molecular Formula | C28H38F4O7 |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [2-(4-hydroxyadamantane-1-carbonyl)oxy-3-(1,1,2,2-tetrafluoropropoxy)propyl] 4-hydroxyadamantane-1-carboxylate |
| SMILES | CC(F)(F)C(F)(F)OCC(COC(=O)C12CC3CC(C1)C(O)C(C3)C2)OC(=O)C12CC3CC(C1)C(O)C(C3)C2 |
| InChI | InChI=1S/C28H38F4O7/c1-25(29,30)28(31,32)38-13-20(39-24(36)27-7-15-4-18(10-27)22(34)19(5-15)11-27)12-37-23(35)26-6-14-2-16(8-26)21(33)17(3-14)9-26/h14-22,33-34H,2-13H2,1H3 |
| InChIKey | AJXUEXJOOGKKNR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|