C27H39F11O4 — CID 160935007
[1-(2,2-dimethylbutanoyloxy)-4,4,5,5,6,7,7,7-octafluoro-6-(trifluoromethyl)heptan-2-yl] adamantane-1-carboxylate;methane (PubChem CID 160935007) has the molecular formula C27H39F11O4 and a molecular weight of 636.58 g/mol. Its IUPAC name is [1-(2,2-dimethylbutanoyloxy)-4,4,5,5,6,7,7,7-octafluoro-6-(trifluoromethyl)heptan-2-yl] adamantane-1-carboxylate;methane.
| Compound Name | [1-(2,2-dimethylbutanoyloxy)-4,4,5,5,6,7,7,7-octafluoro-6-(trifluoromethyl)heptan-2-yl] adamantane-1-carboxylate;methane |
|---|---|
| PubChem CID | 160935007 |
| Molecular Formula | C27H39F11O4 |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | [1-(2,2-dimethylbutanoyloxy)-4,4,5,5,6,7,7,7-octafluoro-6-(trifluoromethyl)heptan-2-yl] adamantane-1-carboxylate;methane |
| SMILES | C.C.CCC(C)(C)C(=O)OCC(CC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H31F11O4.2CH4/c1-4-19(2,3)17(37)39-12-16(40-18(38)20-8-13-5-14(9-20)7-15(6-13)10-20)11-21(26,27)23(29,30)22(28,24(31,32)33)25(34,35)36;;/h13-16H,4-12H2,1-3H3;2*1H4 |
| InChIKey | STTMNOPDXGEXHP-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|