C18H24F2O5 — CID 157416583
[1-(1,1-difluoroethoxy)-3-formyloxypropan-2-yl] 4-methylideneadamantane-1-carboxylate (PubChem CID 157416583) has the molecular formula C18H24F2O5 and a molecular weight of 358.38 g/mol. Its IUPAC name is [1-(1,1-difluoroethoxy)-3-formyloxypropan-2-yl] 4-methylideneadamantane-1-carboxylate.
| Compound Name | [1-(1,1-difluoroethoxy)-3-formyloxypropan-2-yl] 4-methylideneadamantane-1-carboxylate |
|---|---|
| PubChem CID | 157416583 |
| Molecular Formula | C18H24F2O5 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [1-(1,1-difluoroethoxy)-3-formyloxypropan-2-yl] 4-methylideneadamantane-1-carboxylate |
| SMILES | C=C1C2CC3CC1CC(C(=O)OC(COC=O)COC(C)(F)F)(C3)C2 |
| InChI | InChI=1S/C18H24F2O5/c1-11-13-3-12-4-14(11)7-18(5-12,6-13)16(22)25-15(8-23-10-21)9-24-17(2,19)20/h10,12-15H,1,3-9H2,2H3 |
| InChIKey | XBFZQYGDAOMKQZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|