C17H26F2O6 — CID 134590528
[1-(1,1-difluoroethoxy)-3-formyloxypropan-2-yl] 1-ethyl-3-hydroxy-3-methyl-5-methylidenecyclohexane-1-carboxylate (PubChem CID 134590528) has the molecular formula C17H26F2O6 and a molecular weight of 364.39 g/mol. Its IUPAC name is [1-(1,1-difluoroethoxy)-3-formyloxypropan-2-yl] 1-ethyl-3-hydroxy-3-methyl-5-methylidenecyclohexane-1-carboxylate.
| Compound Name | [1-(1,1-difluoroethoxy)-3-formyloxypropan-2-yl] 1-ethyl-3-hydroxy-3-methyl-5-methylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134590528 |
| Molecular Formula | C17H26F2O6 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [1-(1,1-difluoroethoxy)-3-formyloxypropan-2-yl] 1-ethyl-3-hydroxy-3-methyl-5-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1CC(C)(O)CC(CC)(C(=O)OC(COC=O)COC(C)(F)F)C1 |
| InChI | InChI=1S/C17H26F2O6/c1-5-17(7-12(2)6-15(3,22)10-17)14(21)25-13(8-23-11-20)9-24-16(4,18)19/h11,13,22H,2,5-10H2,1,3-4H3 |
| InChIKey | IUWGDQNTACEXLH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|