C17H26F3NO5S — CID 163938780
6-(tricyclo[3.3.1.03,7]nonane-1-carbonyloxy)-N-(trifluoromethylsulfonyl)hexan-1-amine oxide (PubChem CID 163938780) has the molecular formula C17H26F3NO5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 6-(tricyclo[3.3.1.03,7]nonane-1-carbonyloxy)-N-(trifluoromethylsulfonyl)hexan-1-amine oxide.
| Compound Name | 6-(tricyclo[3.3.1.03,7]nonane-1-carbonyloxy)-N-(trifluoromethylsulfonyl)hexan-1-amine oxide |
|---|---|
| PubChem CID | 163938780 |
| Molecular Formula | C17H26F3NO5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 6-(tricyclo[3.3.1.03,7]nonane-1-carbonyloxy)-N-(trifluoromethylsulfonyl)hexan-1-amine oxide |
| SMILES | O=C(OCCCCCC[NH+]([O-])S(=O)(=O)C(F)(F)F)C12CC3CC(C1)C(C3)C2 |
| InChI | InChI=1S/C17H26F3NO5S/c18-17(19,20)27(24,25)21(23)5-3-1-2-4-6-26-15(22)16-9-12-7-13(10-16)14(8-12)11-16/h12-14,21H,1-11H2 |
| InChIKey | RPDRSIBSAANIPP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|