About 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate
4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate (PubChem CID 163492168) has the molecular formula C21H31F3O4S
and a molecular weight of 436.54 g/mol. Its IUPAC name is 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate.
Molecular Properties
| Compound Name | 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate |
| PubChem CID | 163492168 |
| Molecular Formula | C21H31F3O4S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate |
| SMILES | O=C(OCCCCC1CCCC1S(=O)(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H31F3O4S/c22-21(23,24)29(26,27)18-6-3-5-17(18)4-1-2-7-28-19(25)20-11-14-8-15(12-20)10-16(9-14)13-20/h14-18H,1-13H2 |
| InChIKey | CNPJJSCCWVWHEN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate?
The IUPAC name of 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate (CID 163492168) is 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate.
What is the SMILES notation for 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate?
The canonical SMILES for 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate is O=C(OCCCCC1CCCC1S(=O)(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate?
The InChIKey is CNPJJSCCWVWHEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31F3O4S/c22-21(23,24)29(26,27)18-6-3-5-17(18)4-1-2-7-28-19(25)20-11-14-8-15(12-20)10-16(9-14)13-20/h14-18H,1-13H2.
What are the key properties of 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate?
4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate has a molecular weight of 436.54 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(trifluoromethylsulfonyl)cyclopentyl]butyl adamantane-1-carboxylate is sourced from PubChem (CID 163492168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).