C19H30F3NO2 — CID 67966971
6-(2,2,2-trifluoroethylamino)hexyl adamantane-1-carboxylate (PubChem CID 67966971) has the molecular formula C19H30F3NO2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethylamino)hexyl adamantane-1-carboxylate.
| Compound Name | 6-(2,2,2-trifluoroethylamino)hexyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 67966971 |
| Molecular Formula | C19H30F3NO2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 6-(2,2,2-trifluoroethylamino)hexyl adamantane-1-carboxylate |
| SMILES | O=C(OCCCCCCNCC(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H30F3NO2/c20-19(21,22)13-23-5-3-1-2-4-6-25-17(24)18-10-14-7-15(11-18)9-16(8-14)12-18/h14-16,23H,1-13H2 |
| InChIKey | SHKMJKWBHXIBGS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|