C19H22F6O9S — CID 121464149
1,1-difluoro-2-oxo-2-[2,2,3,3-tetrafluoro-4-(spiro[1,3-dioxolane-2,4'-adamantane]-1'-carbonyloxy)butoxy]ethanesulfonic acid (PubChem CID 121464149) has the molecular formula C19H22F6O9S and a molecular weight of 540.43 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[2,2,3,3-tetrafluoro-4-(spiro[1,3-dioxolane-2,4'-adamantane]-1'-carbonyloxy)butoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[2,2,3,3-tetrafluoro-4-(spiro[1,3-dioxolane-2,4'-adamantane]-1'-carbonyloxy)butoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 121464149 |
| Molecular Formula | C19H22F6O9S |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[2,2,3,3-tetrafluoro-4-(spiro[1,3-dioxolane-2,4'-adamantane]-1'-carbonyloxy)butoxy]ethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)C(F)(F)COC(=O)C(F)(F)S(=O)(=O)O)C12CC3CC(C1)C1(OCCO1)C(C3)C2 |
| InChI | InChI=1S/C19H22F6O9S/c20-16(21,17(22,23)9-32-14(27)19(24,25)35(28,29)30)8-31-13(26)15-5-10-3-11(6-15)18(12(4-10)7-15)33-1-2-34-18/h10-12H,1-9H2,(H,28,29,30) |
| InChIKey | PKDPHWOHQAMNNW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|