C22H28F4O6 — CID 122501787
[2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] spiro[1,3-dioxane-2,4'-adamantane]-1'-carboxylate (PubChem CID 122501787) has the molecular formula C22H28F4O6 and a molecular weight of 464.45 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] spiro[1,3-dioxane-2,4'-adamantane]-1'-carboxylate.
| Compound Name | [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] spiro[1,3-dioxane-2,4'-adamantane]-1'-carboxylate |
|---|---|
| PubChem CID | 122501787 |
| Molecular Formula | C22H28F4O6 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoyloxy)butyl] spiro[1,3-dioxane-2,4'-adamantane]-1'-carboxylate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)COC(=O)C12CC3CC(C1)C1(OCCCO1)C(C3)C2 |
| InChI | InChI=1S/C22H28F4O6/c1-13(2)17(27)29-11-20(23,24)21(25,26)12-30-18(28)19-8-14-6-15(9-19)22(16(7-14)10-19)31-4-3-5-32-22/h14-16H,1,3-12H2,2H3 |
| InChIKey | PMUHVVNXYHXJES-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|