C25H22F16O11S — CID 126756005
1,1-difluoro-2-[5-(2,2,3,3,4,4,4-heptafluorobutanoyloxymethyl)-5-(2,2,3,3,4,4,4-heptafluorobutoxycarbonyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxy-2-oxoethanesulfonic acid (PubChem CID 126756005) has the molecular formula C25H22F16O11S and a molecular weight of 834.47 g/mol. Its IUPAC name is 1,1-difluoro-2-[5-(2,2,3,3,4,4,4-heptafluorobutanoyloxymethyl)-5-(2,2,3,3,4,4,4-heptafluorobutoxycarbonyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[5-(2,2,3,3,4,4,4-heptafluorobutanoyloxymethyl)-5-(2,2,3,3,4,4,4-heptafluorobutoxycarbonyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 126756005 |
| Molecular Formula | C25H22F16O11S |
| Molecular Weight | 834.47 g/mol |
| Exact Mass | 834.06 |
| IUPAC Name | 1,1-difluoro-2-[5-(2,2,3,3,4,4,4-heptafluorobutanoyloxymethyl)-5-(2,2,3,3,4,4,4-heptafluorobutoxycarbonyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxy-2-oxoethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)F)C1(COC(=O)C(F)(F)C(F)(F)C(F)(F)F)COC2(OC1)C1CC3CC2CC(OC(=O)C(F)(F)S(=O)(=O)O)(C3)C1 |
| InChI | InChI=1S/C25H22F16O11S/c26-18(27,22(32,33)24(36,37)38)9-49-13(42)16(6-48-14(43)20(28,29)23(34,35)25(39,40)41)7-50-19(51-8-16)11-1-10-2-12(19)5-17(3-10,4-11)52-15(44)21(30,31)53(45,46)47/h10-12H,1-9H2,(H,45,46,47) |
| InChIKey | KCBWKNADKZJGLS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|