C16H17F6O7S- — CID 156674857
1,1-difluoro-2-oxo-2-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl)oxyethanesulfonate (PubChem CID 156674857) has the molecular formula C16H17F6O7S- and a molecular weight of 467.36 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl)oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-oxo-2-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl)oxyethanesulfonate |
|---|---|
| PubChem CID | 156674857 |
| Molecular Formula | C16H17F6O7S- |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-(5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-yl)oxyethanesulfonate |
| SMILES | O=C(OC12CC3CC(C1)C1(OCC(F)(F)C(F)(F)CO1)C(C3)C2)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C16H18F6O7S/c17-13(18)6-27-15(28-7-14(13,19)20)9-1-8-2-10(15)5-12(3-8,4-9)29-11(23)16(21,22)30(24,25)26/h8-10H,1-7H2,(H,24,25,26)/p-1 |
| InChIKey | FTMOSMCLULITEE-UHFFFAOYSA-M |
| XLogP | 2.26 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|