C20H21F2O12S- — CID 169026957
2-(9-acetyloxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl)oxy-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 169026957) has the molecular formula C20H21F2O12S- and a molecular weight of 523.44 g/mol. Its IUPAC name is 2-(9-acetyloxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl)oxy-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-(9-acetyloxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl)oxy-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 169026957 |
| Molecular Formula | C20H21F2O12S- |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 2-(9-acetyloxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-adamantane]-1'-yl)oxy-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CC(=O)OC1C(=O)OC2C3OC4(OC3OC12)C1CC2CC4CC(OC(=O)C(F)(F)S(=O)(=O)[O-])(C2)C1 |
| InChI | InChI=1S/C20H22F2O12S/c1-7(23)29-13-11-12(30-15(13)24)14-16(31-11)33-19(32-14)9-2-8-3-10(19)6-18(4-8,5-9)34-17(25)20(21,22)35(26,27)28/h8-14,16H,2-6H2,1H3,(H,26,27,28)/p-1 |
| InChIKey | VKCOMCUVVWTDKI-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|