C15H22F3NO5S — CID 89449458
2-[hydroxy(trifluoromethylsulfonyl)amino]propyl adamantane-1-carboxylate (PubChem CID 89449458) has the molecular formula C15H22F3NO5S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[hydroxy(trifluoromethylsulfonyl)amino]propyl adamantane-1-carboxylate.
| Compound Name | 2-[hydroxy(trifluoromethylsulfonyl)amino]propyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 89449458 |
| Molecular Formula | C15H22F3NO5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-[hydroxy(trifluoromethylsulfonyl)amino]propyl adamantane-1-carboxylate |
| SMILES | CC(COC(=O)C12CC3CC(CC(C3)C1)C2)N(O)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H22F3NO5S/c1-9(19(21)25(22,23)15(16,17)18)8-24-13(20)14-5-10-2-11(6-14)4-12(3-10)7-14/h9-12,21H,2-8H2,1H3 |
| InChIKey | XQHDRYDRGYIYQG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|