C17H24F2O7S2 — CID 89309933
1,1-difluoro-2-[[5-(1,4-oxathian-2-yloxymethyl)-2-adamantyl]oxy]-2-oxoethanesulfonic acid (PubChem CID 89309933) has the molecular formula C17H24F2O7S2 and a molecular weight of 442.50 g/mol. Its IUPAC name is 1,1-difluoro-2-[[5-(1,4-oxathian-2-yloxymethyl)-2-adamantyl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[5-(1,4-oxathian-2-yloxymethyl)-2-adamantyl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89309933 |
| Molecular Formula | C17H24F2O7S2 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1,1-difluoro-2-[[5-(1,4-oxathian-2-yloxymethyl)-2-adamantyl]oxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(OC1C2CC3CC1CC(COC1CSCCO1)(C3)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C17H24F2O7S2/c18-17(19,28(21,22)23)15(20)26-14-11-3-10-4-12(14)7-16(5-10,6-11)9-25-13-8-27-2-1-24-13/h10-14H,1-9H2,(H,21,22,23) |
| InChIKey | IYXCJKYUVBSFGR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|