C6H8F2O7S — CID 146727546
1,1-difluoro-2-(2-hydroxyoxolan-3-yl)oxy-2-oxoethanesulfonic acid (PubChem CID 146727546) has the molecular formula C6H8F2O7S and a molecular weight of 262.19 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-hydroxyoxolan-3-yl)oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(2-hydroxyoxolan-3-yl)oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 146727546 |
| Molecular Formula | C6H8F2O7S |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1,1-difluoro-2-(2-hydroxyoxolan-3-yl)oxy-2-oxoethanesulfonic acid |
| SMILES | O=C(OC1CCOC1O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C6H8F2O7S/c7-6(8,16(11,12)13)5(10)15-3-1-2-14-4(3)9/h3-4,9H,1-2H2,(H,11,12,13) |
| InChIKey | RGTXTRZEZLAHCW-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|