C7H11F2NO5S — CID 89393960
1,1-difluoro-2-oxo-2-piperidin-4-yloxyethanesulfonic acid (PubChem CID 89393960) has the molecular formula C7H11F2NO5S and a molecular weight of 259.23 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-piperidin-4-yloxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-piperidin-4-yloxyethanesulfonic acid |
|---|---|
| PubChem CID | 89393960 |
| Molecular Formula | C7H11F2NO5S |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-piperidin-4-yloxyethanesulfonic acid |
| SMILES | O=C(OC1CCNCC1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C7H11F2NO5S/c8-7(9,16(12,13)14)6(11)15-5-1-3-10-4-2-5/h5,10H,1-4H2,(H,12,13,14) |
| InChIKey | DWKLPPHFMYOWBB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|