C10H11F7O5S — CID 89040641
1,1-difluoro-2-oxo-2-[4-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]oxyethanesulfonic acid (PubChem CID 89040641) has the molecular formula C10H11F7O5S and a molecular weight of 376.25 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[4-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[4-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 89040641 |
| Molecular Formula | C10H11F7O5S |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[4-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]oxyethanesulfonic acid |
| SMILES | O=C(OC1CCC(C(F)(F)C(F)(F)F)CC1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H11F7O5S/c11-8(12,10(15,16)17)5-1-3-6(4-2-5)22-7(18)9(13,14)23(19,20)21/h5-6H,1-4H2,(H,19,20,21) |
| InChIKey | YCIFUJXHSMYCJO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|