C12H18F2O5S — CID 147652936
2-(2-bicyclo[3.3.2]decanyloxy)-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 147652936) has the molecular formula C12H18F2O5S and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-(2-bicyclo[3.3.2]decanyloxy)-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(2-bicyclo[3.3.2]decanyloxy)-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 147652936 |
| Molecular Formula | C12H18F2O5S |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-(2-bicyclo[3.3.2]decanyloxy)-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OC1CCC2CCCC1CC2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H18F2O5S/c13-12(14,20(16,17)18)11(15)19-10-7-5-8-2-1-3-9(10)6-4-8/h8-10H,1-7H2,(H,16,17,18) |
| InChIKey | GJVYTVAUJUZMOD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|