C9H14F2O5S — CID 87141583
2-cycloheptyloxy-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 87141583) has the molecular formula C9H14F2O5S and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-cycloheptyloxy-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-cycloheptyloxy-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 87141583 |
| Molecular Formula | C9H14F2O5S |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-cycloheptyloxy-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OC1CCCCCC1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C9H14F2O5S/c10-9(11,17(13,14)15)8(12)16-7-5-3-1-2-4-6-7/h7H,1-6H2,(H,13,14,15) |
| InChIKey | WGYGRZNGNQPVKW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|