C9H12F2O5S — CID 59660395
2-(2-bicyclo[2.2.1]heptanyloxy)-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 59660395) has the molecular formula C9H12F2O5S and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyloxy)-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyloxy)-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 59660395 |
| Molecular Formula | C9H12F2O5S |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyloxy)-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OC1CC2CCC1C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C9H12F2O5S/c10-9(11,17(13,14)15)8(12)16-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2,(H,13,14,15) |
| InChIKey | MYGVUAPLVCRLIL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|