C11H19NO2 — CID 58139000
2-bicyclo[2.2.1]heptanyl 2-amino-2-methylpropanoate (PubChem CID 58139000) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 2-amino-2-methylpropanoate.
| Compound Name | 2-bicyclo[2.2.1]heptanyl 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 58139000 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 2-amino-2-methylpropanoate |
| SMILES | CC(C)(N)C(=O)OC1CC2CCC1C2 |
| InChI | InChI=1S/C11H19NO2/c1-11(2,12)10(13)14-9-6-7-3-4-8(9)5-7/h7-9H,3-6,12H2,1-2H3 |
| InChIKey | IFWRYFFHOOMIHY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |