About acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate
acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate (PubChem CID 157193732) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate |
| PubChem CID | 157193732 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CCC1C2.CC#N |
| InChI | InChI=1S/C11H16O2.C2H3N/c1-7(2)11(12)13-10-6-8-3-4-9(10)5-8;1-2-3/h8-10H,1,3-6H2,2H3;1H3 |
| InChIKey | APZPPRDKIOTVGI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate?
The IUPAC name of acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate (CID 157193732) is acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate.
What is the SMILES notation for acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate?
The canonical SMILES for acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate is C=C(C)C(=O)OC1CC2CCC1C2.CC#N.
What is the InChIKey of acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate?
The InChIKey is APZPPRDKIOTVGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2.C2H3N/c1-7(2)11(12)13-10-6-8-3-4-9(10)5-8;1-2-3/h8-10H,1,3-6H2,2H3;1H3.
What are the key properties of acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate?
acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate has a molecular weight of 221.30 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate is sourced from PubChem (CID 157193732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).