C23H38O5 — CID 143139271
2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate;1-(2,3,4-trimethylcyclopentyl)ethyl ethaneperoxoate (PubChem CID 143139271) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate;1-(2,3,4-trimethylcyclopentyl)ethyl ethaneperoxoate.
| Compound Name | 2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate;1-(2,3,4-trimethylcyclopentyl)ethyl ethaneperoxoate |
|---|---|
| PubChem CID | 143139271 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 2-methylprop-2-enoate;1-(2,3,4-trimethylcyclopentyl)ethyl ethaneperoxoate |
| SMILES | C=C(C)C(=O)OC1CC2CCC1C2.CC(=O)OOC(C)C1CC(C)C(C)C1C |
| InChI | InChI=1S/C12H22O3.C11H16O2/c1-7-6-12(9(3)8(7)2)10(4)14-15-11(5)13;1-7(2)11(12)13-10-6-8-3-4-9(10)5-8/h7-10,12H,6H2,1-5H3;8-10H,1,3-6H2,2H3 |
| InChIKey | QUXPYFUSMJMMHI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|