C14H16F6O3 — CID 58823666
2-bicyclo[2.2.1]heptanyl 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)prop-2-enoate (PubChem CID 58823666) has the molecular formula C14H16F6O3 and a molecular weight of 346.27 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)prop-2-enoate.
| Compound Name | 2-bicyclo[2.2.1]heptanyl 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 58823666 |
| Molecular Formula | C14H16F6O3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)prop-2-enoate |
| SMILES | C=C(COC(C(F)(F)F)C(F)(F)F)C(=O)OC1CC2CCC1C2 |
| InChI | InChI=1S/C14H16F6O3/c1-7(6-22-12(13(15,16)17)14(18,19)20)11(21)23-10-5-8-2-3-9(10)4-8/h8-10,12H,1-6H2 |
| InChIKey | BCYOMJQRVRBGIA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|