C12H15NO2 — CID 102070522
[(5R)-5-cyano-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 102070522) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is [(5R)-5-cyano-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | [(5R)-5-cyano-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102070522 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | [(5R)-5-cyano-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C[C@H]2C#N |
| InChI | InChI=1S/C12H15NO2/c1-7(2)12(14)15-11-5-8-3-9(11)4-10(8)6-13/h8-11H,1,3-5H2,2H3/t8?,9?,10-,11?/m0/s1 |
| InChIKey | MXEJXGXAGGYTMV-MWJCJQSMSA-N |
| XLogP | 2.04 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|