C29H48F6O4 — CID 91505939
2-bicyclo[2.2.1]heptanyl 2-methyl-2-(trifluoromethyl)butanoate;decyl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 91505939) has the molecular formula C29H48F6O4 and a molecular weight of 574.69 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 2-methyl-2-(trifluoromethyl)butanoate;decyl 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | 2-bicyclo[2.2.1]heptanyl 2-methyl-2-(trifluoromethyl)butanoate;decyl 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 91505939 |
| Molecular Formula | C29H48F6O4 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 2-methyl-2-(trifluoromethyl)butanoate;decyl 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1CC2CCC1C2)C(F)(F)F.CCCCCCCCCCOC(=O)C(C)(CC)C(F)(F)F |
| InChI | InChI=1S/C16H29F3O2.C13H19F3O2/c1-4-6-7-8-9-10-11-12-13-21-14(20)15(3,5-2)16(17,18)19;1-3-12(2,13(14,15)16)11(17)18-10-7-8-4-5-9(10)6-8/h4-13H2,1-3H3;8-10H,3-7H2,1-2H3 |
| InChIKey | GKYLLBAKFBNFJX-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|