C15H22F2O6S — CID 162504063
1,1-difluoro-2-[[5-(2-hydroxypropan-2-yl)-2-adamantyl]oxy]-2-oxoethanesulfonic acid (PubChem CID 162504063) has the molecular formula C15H22F2O6S and a molecular weight of 368.40 g/mol. Its IUPAC name is 1,1-difluoro-2-[[5-(2-hydroxypropan-2-yl)-2-adamantyl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[5-(2-hydroxypropan-2-yl)-2-adamantyl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 162504063 |
| Molecular Formula | C15H22F2O6S |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1,1-difluoro-2-[[5-(2-hydroxypropan-2-yl)-2-adamantyl]oxy]-2-oxoethanesulfonic acid |
| SMILES | CC(C)(O)C12CC3CC(C1)C(OC(=O)C(F)(F)S(=O)(=O)O)C(C3)C2 |
| InChI | InChI=1S/C15H22F2O6S/c1-13(2,19)14-5-8-3-9(6-14)11(10(4-8)7-14)23-12(18)15(16,17)24(20,21)22/h8-11,19H,3-7H2,1-2H3,(H,20,21,22) |
| InChIKey | FVVSOZIZGPMJMM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|