C24H38F2O8S — CID 146637129
2-[[7-[3-bicyclo[3.3.1]nonanylmethoxymethoxy(hydroxy)methyl]-7-methyl-2-bicyclo[3.3.1]nonanyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 146637129) has the molecular formula C24H38F2O8S and a molecular weight of 524.62 g/mol. Its IUPAC name is 2-[[7-[3-bicyclo[3.3.1]nonanylmethoxymethoxy(hydroxy)methyl]-7-methyl-2-bicyclo[3.3.1]nonanyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[7-[3-bicyclo[3.3.1]nonanylmethoxymethoxy(hydroxy)methyl]-7-methyl-2-bicyclo[3.3.1]nonanyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 146637129 |
| Molecular Formula | C24H38F2O8S |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 2-[[7-[3-bicyclo[3.3.1]nonanylmethoxymethoxy(hydroxy)methyl]-7-methyl-2-bicyclo[3.3.1]nonanyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CC1(C(O)OCOCC2CC3CCCC(C3)C2)CC2CCC(OC(=O)C(F)(F)S(=O)(=O)O)C(C2)C1 |
| InChI | InChI=1S/C24H38F2O8S/c1-23(21(27)33-14-32-13-18-8-15-3-2-4-16(7-15)9-18)11-17-5-6-20(19(10-17)12-23)34-22(28)24(25,26)35(29,30)31/h15-21,27H,2-14H2,1H3,(H,29,30,31) |
| InChIKey | FWEFLUACQWTLIA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|