C25H38F2O8S — CID 126603895
2-[4-[3-(3-bicyclo[3.3.1]nonanylmethoxymethoxy)-2,2-dimethyl-3-oxopropyl]-2-methylidenecyclohexyl]oxy-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 126603895) has the molecular formula C25H38F2O8S and a molecular weight of 536.63 g/mol. Its IUPAC name is 2-[4-[3-(3-bicyclo[3.3.1]nonanylmethoxymethoxy)-2,2-dimethyl-3-oxopropyl]-2-methylidenecyclohexyl]oxy-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[4-[3-(3-bicyclo[3.3.1]nonanylmethoxymethoxy)-2,2-dimethyl-3-oxopropyl]-2-methylidenecyclohexyl]oxy-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 126603895 |
| Molecular Formula | C25H38F2O8S |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2-[4-[3-(3-bicyclo[3.3.1]nonanylmethoxymethoxy)-2,2-dimethyl-3-oxopropyl]-2-methylidenecyclohexyl]oxy-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | C=C1CC(CC(C)(C)C(=O)OCOCC2CC3CCCC(C3)C2)CCC1OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C25H38F2O8S/c1-16-9-19(7-8-21(16)35-23(29)25(26,27)36(30,31)32)13-24(2,3)22(28)34-15-33-14-20-11-17-5-4-6-18(10-17)12-20/h17-21H,1,4-15H2,2-3H3,(H,30,31,32) |
| InChIKey | JGMMXRZAFHTTOA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|