C12H18F2O5S — CID 163832255
1,1-difluoro-2-[(2R)-2-methyl-1-(2-methylidenecyclobutyl)butan-2-yl]oxy-2-oxoethanesulfonic acid (PubChem CID 163832255) has the molecular formula C12H18F2O5S and a molecular weight of 312.33 g/mol. Its IUPAC name is 1,1-difluoro-2-[(2R)-2-methyl-1-(2-methylidenecyclobutyl)butan-2-yl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(2R)-2-methyl-1-(2-methylidenecyclobutyl)butan-2-yl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163832255 |
| Molecular Formula | C12H18F2O5S |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1,1-difluoro-2-[(2R)-2-methyl-1-(2-methylidenecyclobutyl)butan-2-yl]oxy-2-oxoethanesulfonic acid |
| SMILES | C=C1CCC1C[C@@](C)(CC)OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H18F2O5S/c1-4-11(3,7-9-6-5-8(9)2)19-10(15)12(13,14)20(16,17)18/h9H,2,4-7H2,1,3H3,(H,16,17,18)/t9?,11-/m1/s1 |
| InChIKey | OEQFLMAZJZOMQR-HCCKASOXSA-N |
| XLogP | 2.54 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|