C10H10F2O5S — CID 140653925
2-(4-ethylphenoxy)-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 140653925) has the molecular formula C10H10F2O5S and a molecular weight of 280.25 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(4-ethylphenoxy)-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 140653925 |
| Molecular Formula | C10H10F2O5S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-(4-ethylphenoxy)-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCc1ccc(OC(=O)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H10F2O5S/c1-2-7-3-5-8(6-4-7)17-9(13)10(11,12)18(14,15)16/h3-6H,2H2,1H3,(H,14,15,16) |
| InChIKey | XUGRHSXCLJUPCO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|