C24H17F8O7S2+ — CID 162423171
[4-(2,2-difluoro-2-sulfoacetyl)oxyphenyl]-phenyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium (PubChem CID 162423171) has the molecular formula C24H17F8O7S2+ and a molecular weight of 633.51 g/mol. Its IUPAC name is [4-(2,2-difluoro-2-sulfoacetyl)oxyphenyl]-phenyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium.
| Compound Name | [4-(2,2-difluoro-2-sulfoacetyl)oxyphenyl]-phenyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 162423171 |
| Molecular Formula | C24H17F8O7S2+ |
| Molecular Weight | 633.51 g/mol |
| Exact Mass | 633.03 |
| IUPAC Name | [4-(2,2-difluoro-2-sulfoacetyl)oxyphenyl]-phenyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
| SMILES | O=C(Oc1ccc([S+](c2ccccc2)c2ccc(OCC(O)(C(F)(F)F)C(F)(F)F)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C24H16F8O7S2/c25-22(26,41(35,36)37)20(33)39-16-8-12-19(13-9-16)40(17-4-2-1-3-5-17)18-10-6-15(7-11-18)38-14-21(34,23(27,28)29)24(30,31)32/h1-13,34H,14H2/p+1 |
| InChIKey | YMWIWFRZDQXAAD-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|