C14H17F6O2S+ — CID 140916015
diethyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium (PubChem CID 140916015) has the molecular formula C14H17F6O2S+ and a molecular weight of 363.34 g/mol. Its IUPAC name is diethyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium.
| Compound Name | diethyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 140916015 |
| Molecular Formula | C14H17F6O2S+ |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | diethyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
| SMILES | CC[S+](CC)c1ccc(OCC(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F6O2S/c1-3-23(4-2)11-7-5-10(6-8-11)22-9-12(21,13(15,16)17)14(18,19)20/h5-8,21H,3-4,9H2,1-2H3/q+1 |
| InChIKey | JBENUOBFWRCVCI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|