C23H21F4O4S2+ — CID 154594580
bis(4-methylphenyl)-[4-(2,3,3,3-tetrafluoro-2-sulfopropoxy)phenyl]sulfanium (PubChem CID 154594580) has the molecular formula C23H21F4O4S2+ and a molecular weight of 501.54 g/mol. Its IUPAC name is bis(4-methylphenyl)-[4-(2,3,3,3-tetrafluoro-2-sulfopropoxy)phenyl]sulfanium.
| Compound Name | bis(4-methylphenyl)-[4-(2,3,3,3-tetrafluoro-2-sulfopropoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 154594580 |
| Molecular Formula | C23H21F4O4S2+ |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | bis(4-methylphenyl)-[4-(2,3,3,3-tetrafluoro-2-sulfopropoxy)phenyl]sulfanium |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2ccc(OCC(F)(C(F)(F)F)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H20F4O4S2/c1-16-3-9-19(10-4-16)32(20-11-5-17(2)6-12-20)21-13-7-18(8-14-21)31-15-22(24,23(25,26)27)33(28,29)30/h3-14H,15H2,1-2H3/p+1 |
| InChIKey | NDJNEOULOLAGNS-UHFFFAOYSA-O |
| XLogP | 5.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|