C26H28F2O4S2+2 — CID 161420890
(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-(4-methylphenyl)sulfanium (PubChem CID 161420890) has the molecular formula C26H28F2O4S2+2 and a molecular weight of 506.64 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-(4-methylphenyl)sulfanium.
| Compound Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 161420890 |
| Molecular Formula | C26H28F2O4S2+2 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-(4-methylphenyl)sulfanium |
| SMILES | [CH2+]C(Oc1ccc([S+](c2ccc(C)cc2)c2ccc(C(C)(C)C)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C26H27F2O4S2/c1-18-6-12-22(13-7-18)33(23-14-8-20(9-15-23)25(3,4)5)24-16-10-21(11-17-24)32-19(2)26(27,28)34(29,30)31/h6-17,19H,2H2,1,3-5H3/q+1/p+1 |
| InChIKey | ZAEIVUIJEGGEFK-UHFFFAOYSA-O |
| XLogP | 6.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|