C23H22F2O4S2+2 — CID 161420888
[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-bis(4-methylphenyl)sulfanium (PubChem CID 161420888) has the molecular formula C23H22F2O4S2+2 and a molecular weight of 464.56 g/mol. Its IUPAC name is [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-bis(4-methylphenyl)sulfanium.
| Compound Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-bis(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 161420888 |
| Molecular Formula | C23H22F2O4S2+2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-bis(4-methylphenyl)sulfanium |
| SMILES | [CH2+]C(Oc1ccc([S+](c2ccc(C)cc2)c2ccc(C)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C23H21F2O4S2/c1-16-4-10-20(11-5-16)30(21-12-6-17(2)7-13-21)22-14-8-19(9-15-22)29-18(3)23(24,25)31(26,27)28/h4-15,18H,3H2,1-2H3/q+1/p+1 |
| InChIKey | PTCZNPYNCNXVST-UHFFFAOYSA-O |
| XLogP | 5.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|