C24H22F3O6S2+ — CID 159393276
[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(4-fluoro-2-methyl-1,3-dioxetan-2-yl)phenyl]-phenylsulfanium (PubChem CID 159393276) has the molecular formula C24H22F3O6S2+ and a molecular weight of 527.56 g/mol. Its IUPAC name is [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(4-fluoro-2-methyl-1,3-dioxetan-2-yl)phenyl]-phenylsulfanium.
| Compound Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(4-fluoro-2-methyl-1,3-dioxetan-2-yl)phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 159393276 |
| Molecular Formula | C24H22F3O6S2+ |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | [4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(4-fluoro-2-methyl-1,3-dioxetan-2-yl)phenyl]-phenylsulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccccc2)c2ccc(C3(C)OC(F)O3)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C24H21F3O6S2/c1-16(24(26,27)35(28,29)30)31-18-10-14-21(15-11-18)34(19-6-4-3-5-7-19)20-12-8-17(9-13-20)23(2)32-22(25)33-23/h3-16,22H,1-2H3/p+1 |
| InChIKey | SHBZIZDZQFEKBS-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|