C28H31F2O6S2+ — CID 159393279
[4-(4-tert-butyl-2-methyl-1,3-dioxetan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium (PubChem CID 159393279) has the molecular formula C28H31F2O6S2+ and a molecular weight of 565.68 g/mol. Its IUPAC name is [4-(4-tert-butyl-2-methyl-1,3-dioxetan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium.
| Compound Name | [4-(4-tert-butyl-2-methyl-1,3-dioxetan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 159393279 |
| Molecular Formula | C28H31F2O6S2+ |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | [4-(4-tert-butyl-2-methyl-1,3-dioxetan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccccc2)c2ccc(C3(C)OC(C(C)(C)C)O3)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C28H30F2O6S2/c1-19(28(29,30)38(31,32)33)34-21-13-17-24(18-14-21)37(22-9-7-6-8-10-22)23-15-11-20(12-16-23)27(5)35-25(36-27)26(2,3)4/h6-19,25H,1-5H3/p+1 |
| InChIKey | UIQZKYHSTBSZIA-UHFFFAOYSA-O |
| XLogP | 6.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|