C30H33F4O6S2+ — CID 159160820
[4-(4-tert-butyl-5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium (PubChem CID 159160820) has the molecular formula C30H33F4O6S2+ and a molecular weight of 629.71 g/mol. Its IUPAC name is [4-(4-tert-butyl-5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium.
| Compound Name | [4-(4-tert-butyl-5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 159160820 |
| Molecular Formula | C30H33F4O6S2+ |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | [4-(4-tert-butyl-5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-phenylsulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccccc2)c2ccc(C3(C)OCC(F)(F)C(C(C)(C)C)O3)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C30H32F4O6S2/c1-20(30(33,34)42(35,36)37)39-22-13-17-25(18-14-22)41(23-9-7-6-8-10-23)24-15-11-21(12-16-24)28(5)38-19-29(31,32)26(40-28)27(2,3)4/h6-18,20,26H,19H2,1-5H3/p+1 |
| InChIKey | MKYADKKDKZSWAV-UHFFFAOYSA-O |
| XLogP | 7.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|