C34H43F2O6S2+ — CID 159079776
(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2,6,6-trimethyl-1,3-dioxocan-2-yl)phenyl]sulfanium (PubChem CID 159079776) has the molecular formula C34H43F2O6S2+ and a molecular weight of 649.84 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2,6,6-trimethyl-1,3-dioxocan-2-yl)phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2,6,6-trimethyl-1,3-dioxocan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 159079776 |
| Molecular Formula | C34H43F2O6S2+ |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(2,6,6-trimethyl-1,3-dioxocan-2-yl)phenyl]sulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C3(C)OCCC(C)(C)CCO3)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C34H42F2O6S2/c1-24(34(35,36)44(37,38)39)42-27-12-18-30(19-13-27)43(28-14-8-25(9-15-28)31(2,3)4)29-16-10-26(11-17-29)33(7)40-22-20-32(5,6)21-23-41-33/h8-19,24H,20-23H2,1-7H3/p+1 |
| InChIKey | XMCXFLMMYCAQBM-UHFFFAOYSA-O |
| XLogP | 8.35 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|