C30H33F4O6S2+ — CID 158262308
(4-tert-butylphenyl)-[3-(5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]sulfanium (PubChem CID 158262308) has the molecular formula C30H33F4O6S2+ and a molecular weight of 629.71 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[3-(5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-[3-(5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 158262308 |
| Molecular Formula | C30H33F4O6S2+ |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | (4-tert-butylphenyl)-[3-(5,5-difluoro-2-methyl-1,3-dioxan-2-yl)phenyl]-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]sulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccc(C(C)(C)C)cc2)c2cccc(C3(C)OCC(F)(F)CO3)c2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C30H32F4O6S2/c1-20(30(33,34)42(35,36)37)40-23-11-15-25(16-12-23)41(24-13-9-21(10-14-24)27(2,3)4)26-8-6-7-22(17-26)28(5)38-18-29(31,32)19-39-28/h6-17,20H,18-19H2,1-5H3/p+1 |
| InChIKey | SBWAMTPNHOLRHZ-UHFFFAOYSA-O |
| XLogP | 7.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|