C31H33F6O6S2+ — CID 157352153
(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(5,5,6,6-tetrafluoro-2-methyl-1,3-dioxepan-2-yl)phenyl]sulfanium (PubChem CID 157352153) has the molecular formula C31H33F6O6S2+ and a molecular weight of 679.72 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(5,5,6,6-tetrafluoro-2-methyl-1,3-dioxepan-2-yl)phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(5,5,6,6-tetrafluoro-2-methyl-1,3-dioxepan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 157352153 |
| Molecular Formula | C31H33F6O6S2+ |
| Molecular Weight | 679.72 g/mol |
| Exact Mass | 679.16 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-(5,5,6,6-tetrafluoro-2-methyl-1,3-dioxepan-2-yl)phenyl]sulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C3(C)OCC(F)(F)C(F)(F)CO3)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C31H32F6O6S2/c1-20(31(36,37)45(38,39)40)43-23-10-16-26(17-11-23)44(24-12-6-21(7-13-24)27(2,3)4)25-14-8-22(9-15-25)28(5)41-18-29(32,33)30(34,35)19-42-28/h6-17,20H,18-19H2,1-5H3/p+1 |
| InChIKey | WJKRITNBOZQYSP-UHFFFAOYSA-O |
| XLogP | 7.82 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.72 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|