C33H39F2O7S2+ — CID 157381954
(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxycarbonylphenyl]-[4-(2-methyl-1,3-dioxocan-2-yl)phenyl]sulfanium (PubChem CID 157381954) has the molecular formula C33H39F2O7S2+ and a molecular weight of 649.80 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxycarbonylphenyl]-[4-(2-methyl-1,3-dioxocan-2-yl)phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxycarbonylphenyl]-[4-(2-methyl-1,3-dioxocan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 157381954 |
| Molecular Formula | C33H39F2O7S2+ |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.21 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxycarbonylphenyl]-[4-(2-methyl-1,3-dioxocan-2-yl)phenyl]sulfanium |
| SMILES | CC(OC(=O)c1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C3(C)OCCCCCO3)cc2)cc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C33H38F2O7S2/c1-23(33(34,35)44(37,38)39)42-30(36)24-9-15-27(16-10-24)43(28-17-11-25(12-18-28)31(2,3)4)29-19-13-26(14-20-29)32(5)40-21-7-6-8-22-41-32/h9-20,23H,6-8,21-22H2,1-5H3/p+1 |
| InChIKey | HBPCWRUMGRDJSK-UHFFFAOYSA-O |
| XLogP | 7.50 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|