C31H35F2O8S2+ — CID 159142997
[4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxyacetyl]oxy-3,5-dimethylphenyl]-[4-(2-methyl-1,3-dioxepan-2-yl)phenyl]-phenylsulfanium (PubChem CID 159142997) has the molecular formula C31H35F2O8S2+ and a molecular weight of 637.74 g/mol. Its IUPAC name is [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxyacetyl]oxy-3,5-dimethylphenyl]-[4-(2-methyl-1,3-dioxepan-2-yl)phenyl]-phenylsulfanium.
| Compound Name | [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxyacetyl]oxy-3,5-dimethylphenyl]-[4-(2-methyl-1,3-dioxepan-2-yl)phenyl]-phenylsulfanium |
|---|---|
| PubChem CID | 159142997 |
| Molecular Formula | C31H35F2O8S2+ |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxyacetyl]oxy-3,5-dimethylphenyl]-[4-(2-methyl-1,3-dioxepan-2-yl)phenyl]-phenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccc(C3(C)OCCCCO3)cc2)cc(C)c1OC(=O)COC(C)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C31H34F2O8S2/c1-21-18-27(19-22(2)29(21)41-28(34)20-38-23(3)31(32,33)43(35,36)37)42(25-10-6-5-7-11-25)26-14-12-24(13-15-26)30(4)39-16-8-9-17-40-30/h5-7,10-15,18-19,23H,8-9,16-17,20H2,1-4H3/p+1 |
| InChIKey | AIYWDFVPADEXCT-UHFFFAOYSA-O |
| XLogP | 6.19 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|