C28H28F5O6S2+ — CID 155623608
[3-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]-phenyl-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium (PubChem CID 155623608) has the molecular formula C28H28F5O6S2+ and a molecular weight of 619.65 g/mol. Its IUPAC name is [3-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]-phenyl-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium.
| Compound Name | [3-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]-phenyl-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 155623608 |
| Molecular Formula | C28H28F5O6S2+ |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | [3-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]-phenyl-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium |
| SMILES | CC1(C)COC(C)(c2ccc([S+](c3ccccc3)c3cccc(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c3)cc2)OC1 |
| InChI | InChI=1S/C28H27F5O6S2/c1-25(2)17-37-26(3,38-18-25)19-12-14-22(15-13-19)40(21-9-5-4-6-10-21)23-11-7-8-20(16-23)39-24(27(29,30)31)28(32,33)41(34,35)36/h4-16,24H,17-18H2,1-3H3/p+1 |
| InChIKey | ZTGNSDRMDRNIJW-UHFFFAOYSA-O |
| XLogP | 6.82 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|