C20H20F5NO4S2+2 — CID 155601565
ethyl-(1-methyl-3H-indol-1-ium-3-yl)-[3-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]sulfanium (PubChem CID 155601565) has the molecular formula C20H20F5NO4S2+2 and a molecular weight of 497.51 g/mol. Its IUPAC name is ethyl-(1-methyl-3H-indol-1-ium-3-yl)-[3-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]sulfanium.
| Compound Name | ethyl-(1-methyl-3H-indol-1-ium-3-yl)-[3-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 155601565 |
| Molecular Formula | C20H20F5NO4S2+2 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | ethyl-(1-methyl-3H-indol-1-ium-3-yl)-[3-(1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxyphenyl]sulfanium |
| SMILES | CC[S+](c1cccc(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1)C1C=[N+](C)c2ccccc21 |
| InChI | InChI=1S/C20H19F5NO4S2/c1-3-31(17-12-26(2)16-10-5-4-9-15(16)17)14-8-6-7-13(11-14)30-18(19(21,22)23)20(24,25)32(27,28)29/h4-12,17-18H,3H2,1-2H3/q+1/p+1 |
| InChIKey | AGERRWZLJCYRPW-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|